C21H17BrN6O8S2 — CID 88649582
(4-nitrophenyl)methyl (6R)-7-[[(2Z)-2-(5-bromo-2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88649582) has the molecular formula C21H17BrN6O8S2 and a molecular weight of 625.44 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6R)-7-[[(2Z)-2-(5-bromo-2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (6R)-7-[[(2Z)-2-(5-bromo-2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88649582 |
| Molecular Formula | C21H17BrN6O8S2 |
| Molecular Weight | 625.44 g/mol |
| Exact Mass | 623.97 |
| IUPAC Name | (4-nitrophenyl)methyl (6R)-7-[[(2Z)-2-(5-bromo-2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CO/N=C(\C(=O)NC1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=CCS[C@H]12)c1nc(NC=O)sc1Br |
| InChI | InChI=1S/C21H17BrN6O8S2/c1-35-26-14(13-16(22)38-21(25-13)23-9-29)17(30)24-15-18(31)27-12(6-7-37-19(15)27)20(32)36-8-10-2-4-11(5-3-10)28(33)34/h2-6,9,15,19H,7-8H2,1H3,(H,24,30)(H,23,25,29)/b26-14-/t15?,19-/m1/s1 |
| InChIKey | IAEYMCIYQWDGAH-YSSMVXEBSA-N |
| XLogP | 1.76 |
| TPSA | 182.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.44 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|