C24H18FN7O7S2 — CID 13138045
(4-nitrophenyl)methyl 7-[[(2E)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(4-fluorophenoxy)iminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 13138045) has the molecular formula C24H18FN7O7S2 and a molecular weight of 599.58 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 7-[[(2E)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(4-fluorophenoxy)iminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 7-[[(2E)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(4-fluorophenoxy)iminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 13138045 |
| Molecular Formula | C24H18FN7O7S2 |
| Molecular Weight | 599.58 g/mol |
| Exact Mass | 599.07 |
| IUPAC Name | (4-nitrophenyl)methyl 7-[[(2E)-2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(4-fluorophenoxy)iminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | Nc1nc(/C(=N\Oc2ccc(F)cc2)C(=O)NC2C(=O)N3C(C(=O)OCc4ccc([N+](=O)[O-])cc4)=CCSC23)ns1 |
| InChI | InChI=1S/C24H18FN7O7S2/c25-13-3-7-15(8-4-13)39-29-17(19-28-24(26)41-30-19)20(33)27-18-21(34)31-16(9-10-40-22(18)31)23(35)38-11-12-1-5-14(6-2-12)32(36)37/h1-9,18,22H,10-11H2,(H,27,33)(H2,26,28,30)/b29-17+ |
| InChIKey | LROKZLDLAVQUFI-STBIYBPSSA-N |
| XLogP | 1.98 |
| TPSA | 192.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.58 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|