C13H9BrN2O5S — CID 11280588
(4-nitrophenyl)methyl (5R,6S)-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 11280588) has the molecular formula C13H9BrN2O5S and a molecular weight of 385.20 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (5R,6S)-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (5R,6S)-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 11280588 |
| Molecular Formula | C13H9BrN2O5S |
| Molecular Weight | 385.20 g/mol |
| Exact Mass | 383.94 |
| IUPAC Name | (4-nitrophenyl)methyl (5R,6S)-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | O=C(OCc1ccc([N+](=O)[O-])cc1)C1=CS[C@@H]2[C@@H](Br)C(=O)N12 |
| InChI | InChI=1S/C13H9BrN2O5S/c14-10-11(17)15-9(6-22-12(10)15)13(18)21-5-7-1-3-8(4-2-7)16(19)20/h1-4,6,10,12H,5H2/t10-,12+/m0/s1 |
| InChIKey | BCQLGSCBQKKBIM-CMPLNLGQSA-N |
| XLogP | 2.16 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.20 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|