C21H19N5O7S — CID 70485283
(4-nitrophenyl)methyl (5R)-6-[acetyloxy-(5,6-dimethyl-1,2,4-triazin-3-yl)methyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 70485283) has the molecular formula C21H19N5O7S and a molecular weight of 485.48 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (5R)-6-[acetyloxy-(5,6-dimethyl-1,2,4-triazin-3-yl)methyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (5R)-6-[acetyloxy-(5,6-dimethyl-1,2,4-triazin-3-yl)methyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 70485283 |
| Molecular Formula | C21H19N5O7S |
| Molecular Weight | 485.48 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | (4-nitrophenyl)methyl (5R)-6-[acetyloxy-(5,6-dimethyl-1,2,4-triazin-3-yl)methyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CC(=O)OC(c1nnc(C)c(C)n1)C1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=CS[C@H]12 |
| InChI | InChI=1S/C21H19N5O7S/c1-10-11(2)23-24-18(22-10)17(33-12(3)27)16-19(28)25-15(9-34-20(16)25)21(29)32-8-13-4-6-14(7-5-13)26(30)31/h4-7,9,16-17,20H,8H2,1-3H3/t16?,17?,20-/m1/s1 |
| InChIKey | FSXSDQYNQSKJDF-LBXVMSDZSA-N |
| XLogP | 2.12 |
| TPSA | 154.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.48 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|