C23H22BrN5O7S — CID 68688925
(4-nitrophenyl)methyl (5S,6S)-6-[acetyloxy-(7-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl)methyl]-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 68688925) has the molecular formula C23H22BrN5O7S and a molecular weight of 592.43 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (5S,6S)-6-[acetyloxy-(7-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl)methyl]-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (5S,6S)-6-[acetyloxy-(7-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl)methyl]-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 68688925 |
| Molecular Formula | C23H22BrN5O7S |
| Molecular Weight | 592.43 g/mol |
| Exact Mass | 591.04 |
| IUPAC Name | (4-nitrophenyl)methyl (5S,6S)-6-[acetyloxy-(7-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl)methyl]-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CC(=O)OC(c1cn2c(n1)CN(C)CC2)[C@]1(Br)C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=CS[C@H]21 |
| InChI | InChI=1S/C23H22BrN5O7S/c1-13(30)36-19(16-9-27-8-7-26(2)10-18(27)25-16)23(24)21(32)28-17(12-37-22(23)28)20(31)35-11-14-3-5-15(6-4-14)29(33)34/h3-6,9,12,19,22H,7-8,10-11H2,1-2H3/t19?,22-,23-/m0/s1 |
| InChIKey | LKUHLVONNAFDQX-MXQSGTKOSA-N |
| XLogP | 2.47 |
| TPSA | 137.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|