C17H16Br2N2O6S — CID 54149905
(4-nitrophenyl)methyl 2-[(2R)-2-acetylsulfanyl-3,3-dibromo-4-oxoazetidin-1-yl]-3-methylbut-3-enoate (PubChem CID 54149905) has the molecular formula C17H16Br2N2O6S and a molecular weight of 536.20 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[(2R)-2-acetylsulfanyl-3,3-dibromo-4-oxoazetidin-1-yl]-3-methylbut-3-enoate.
| Compound Name | (4-nitrophenyl)methyl 2-[(2R)-2-acetylsulfanyl-3,3-dibromo-4-oxoazetidin-1-yl]-3-methylbut-3-enoate |
|---|---|
| PubChem CID | 54149905 |
| Molecular Formula | C17H16Br2N2O6S |
| Molecular Weight | 536.20 g/mol |
| Exact Mass | 533.91 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[(2R)-2-acetylsulfanyl-3,3-dibromo-4-oxoazetidin-1-yl]-3-methylbut-3-enoate |
| SMILES | C=C(C)C(C(=O)OCc1ccc([N+](=O)[O-])cc1)N1C(=O)C(Br)(Br)[C@H]1SC(C)=O |
| InChI | InChI=1S/C17H16Br2N2O6S/c1-9(2)13(20-15(24)17(18,19)16(20)28-10(3)22)14(23)27-8-11-4-6-12(7-5-11)21(25)26/h4-7,13,16H,1,8H2,2-3H3/t13?,16-/m1/s1 |
| InChIKey | OHAHLVUOSPQYHN-FQNRMIAFSA-N |
| XLogP | 3.52 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.20 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|