C15H14Br2N2O5S — CID 88518048
(4-nitrophenyl)methyl 2-(3,3-dibromo-2-oxo-1-sulfidoazetidin-1-ium-1-yl)-3-methylbut-2-enoate (PubChem CID 88518048) has the molecular formula C15H14Br2N2O5S and a molecular weight of 494.16 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-(3,3-dibromo-2-oxo-1-sulfidoazetidin-1-ium-1-yl)-3-methylbut-2-enoate.
| Compound Name | (4-nitrophenyl)methyl 2-(3,3-dibromo-2-oxo-1-sulfidoazetidin-1-ium-1-yl)-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 88518048 |
| Molecular Formula | C15H14Br2N2O5S |
| Molecular Weight | 494.16 g/mol |
| Exact Mass | 491.90 |
| IUPAC Name | (4-nitrophenyl)methyl 2-(3,3-dibromo-2-oxo-1-sulfidoazetidin-1-ium-1-yl)-3-methylbut-2-enoate |
| SMILES | CC(C)=C(C(=O)OCc1ccc([N+](=O)[O-])cc1)[N+]1([S-])CC(Br)(Br)C1=O |
| InChI | InChI=1S/C15H14Br2N2O5S/c1-9(2)12(19(25)8-15(16,17)14(19)21)13(20)24-7-10-3-5-11(6-4-10)18(22)23/h3-6H,7-8H2,1-2H3 |
| InChIKey | VYTKNOALKYVHCZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.16 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|