C14H14NO7S- — CID 67902325
3-ethylsulfanyl-5-[(4-nitrophenyl)methoxy]-4,5-dioxopentanoate (PubChem CID 67902325) has the molecular formula C14H14NO7S- and a molecular weight of 340.33 g/mol. Its IUPAC name is 3-ethylsulfanyl-5-[(4-nitrophenyl)methoxy]-4,5-dioxopentanoate.
| Compound Name | 3-ethylsulfanyl-5-[(4-nitrophenyl)methoxy]-4,5-dioxopentanoate |
|---|---|
| PubChem CID | 67902325 |
| Molecular Formula | C14H14NO7S- |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 3-ethylsulfanyl-5-[(4-nitrophenyl)methoxy]-4,5-dioxopentanoate |
| SMILES | CCSC(CC(=O)[O-])C(=O)C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H15NO7S/c1-2-23-11(7-12(16)17)13(18)14(19)22-8-9-3-5-10(6-4-9)15(20)21/h3-6,11H,2,7-8H2,1H3,(H,16,17)/p-1 |
| InChIKey | VZUKREAXHNGBGU-UHFFFAOYSA-M |
| XLogP | 0.47 |
| TPSA | 126.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|