C14H17N2O7+ — CID 57132632
(2R)-4-hydroxy-2-methyl-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57132632) has the molecular formula C14H17N2O7+ and a molecular weight of 325.30 g/mol. Its IUPAC name is (2R)-4-hydroxy-2-methyl-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-4-hydroxy-2-methyl-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57132632 |
| Molecular Formula | C14H17N2O7+ |
| Molecular Weight | 325.30 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | (2R)-4-hydroxy-2-methyl-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-1-ium-1-carboxylic acid |
| SMILES | C[C@@H]1CC(O)C[N+]1(C(=O)O)C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H16N2O7/c1-9-6-12(17)7-16(9,13(18)19)14(20)23-8-10-2-4-11(5-3-10)15(21)22/h2-5,9,12,17H,6-8H2,1H3/p+1/t9-,12?,16?/m1/s1 |
| InChIKey | AVTSKIARFCREOL-KADTZOLHSA-O |
| XLogP | 1.88 |
| TPSA | 126.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|