C16H15N3O7 — CID 155229433
(4-nitrophenyl)methyl 4-(3-acetyl-4-oxoazetidin-2-yl)-2-imino-3-oxobutanoate (PubChem CID 155229433) has the molecular formula C16H15N3O7 and a molecular weight of 361.31 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 4-(3-acetyl-4-oxoazetidin-2-yl)-2-imino-3-oxobutanoate.
| Compound Name | (4-nitrophenyl)methyl 4-(3-acetyl-4-oxoazetidin-2-yl)-2-imino-3-oxobutanoate |
|---|---|
| PubChem CID | 155229433 |
| Molecular Formula | C16H15N3O7 |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | (4-nitrophenyl)methyl 4-(3-acetyl-4-oxoazetidin-2-yl)-2-imino-3-oxobutanoate |
| SMILES | [H]/N=C(\C(=O)CC1NC(=O)C1C(C)=O)C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H15N3O7/c1-8(20)13-11(18-15(13)22)6-12(21)14(17)16(23)26-7-9-2-4-10(5-3-9)19(24)25/h2-5,11,13,17H,6-7H2,1H3,(H,18,22)/b17-14+ |
| InChIKey | KTZMDVOIVHZSLW-SAPNQHFASA-N |
| XLogP | 0.32 |
| TPSA | 156.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|