C17H19N3O7 — CID 11003342
(4-nitrophenyl)methyl (4R)-4-[(2R,3S)-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-2-yl]-2-imino-3-oxopentanoate (PubChem CID 11003342) has the molecular formula C17H19N3O7 and a molecular weight of 377.35 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (4R)-4-[(2R,3S)-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-2-yl]-2-imino-3-oxopentanoate.
| Compound Name | (4-nitrophenyl)methyl (4R)-4-[(2R,3S)-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-2-yl]-2-imino-3-oxopentanoate |
|---|---|
| PubChem CID | 11003342 |
| Molecular Formula | C17H19N3O7 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | (4-nitrophenyl)methyl (4R)-4-[(2R,3S)-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-2-yl]-2-imino-3-oxopentanoate |
| SMILES | [H]/N=C(/C(=O)OCc1ccc([N+](=O)[O-])cc1)C(=O)[C@H](C)[C@H]1NC(=O)[C@@H]1[C@@H](C)O |
| InChI | InChI=1S/C17H19N3O7/c1-8(14-12(9(2)21)16(23)19-14)15(22)13(18)17(24)27-7-10-3-5-11(6-4-10)20(25)26/h3-6,8-9,12,14,18,21H,7H2,1-2H3,(H,19,23)/b18-13+/t8-,9-,12-,14-/m1/s1 |
| InChIKey | GYKCSZJUAIOBNG-KGBKOFNNSA-N |
| XLogP | 0.36 |
| TPSA | 159.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|