C15H13N3O8 — CID 155229429
2-[3-imino-4-[(4-nitrophenyl)methoxy]-2,4-dioxobutyl]-4-oxoazetidine-3-carboxylic acid (PubChem CID 155229429) has the molecular formula C15H13N3O8 and a molecular weight of 363.28 g/mol. Its IUPAC name is 2-[3-imino-4-[(4-nitrophenyl)methoxy]-2,4-dioxobutyl]-4-oxoazetidine-3-carboxylic acid.
| Compound Name | 2-[3-imino-4-[(4-nitrophenyl)methoxy]-2,4-dioxobutyl]-4-oxoazetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 155229429 |
| Molecular Formula | C15H13N3O8 |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 2-[3-imino-4-[(4-nitrophenyl)methoxy]-2,4-dioxobutyl]-4-oxoazetidine-3-carboxylic acid |
| SMILES | [H]/N=C(\C(=O)CC1NC(=O)C1C(=O)O)C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H13N3O8/c16-12(10(19)5-9-11(14(21)22)13(20)17-9)15(23)26-6-7-1-3-8(4-2-7)18(24)25/h1-4,9,11,16H,5-6H2,(H,17,20)(H,21,22)/b16-12+ |
| InChIKey | OPPWJSRAKRBZOU-FOWTUZBSSA-N |
| XLogP | -0.18 |
| TPSA | 176.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|