C25H23N5O11 — CID 54393073
(4-nitrophenyl)methyl 2-diazo-4-[(2R,3R)-3-[2-[(4-nitrophenyl)methoxycarbonyloxy]propan-2-yl]-4-oxoazetidin-2-yl]-3-oxobutanoate (PubChem CID 54393073) has the molecular formula C25H23N5O11 and a molecular weight of 569.48 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-diazo-4-[(2R,3R)-3-[2-[(4-nitrophenyl)methoxycarbonyloxy]propan-2-yl]-4-oxoazetidin-2-yl]-3-oxobutanoate.
| Compound Name | (4-nitrophenyl)methyl 2-diazo-4-[(2R,3R)-3-[2-[(4-nitrophenyl)methoxycarbonyloxy]propan-2-yl]-4-oxoazetidin-2-yl]-3-oxobutanoate |
|---|---|
| PubChem CID | 54393073 |
| Molecular Formula | C25H23N5O11 |
| Molecular Weight | 569.48 g/mol |
| Exact Mass | 569.14 |
| IUPAC Name | (4-nitrophenyl)methyl 2-diazo-4-[(2R,3R)-3-[2-[(4-nitrophenyl)methoxycarbonyloxy]propan-2-yl]-4-oxoazetidin-2-yl]-3-oxobutanoate |
| SMILES | CC(C)(OC(=O)OCc1ccc([N+](=O)[O-])cc1)[C@@H]1C(=O)N[C@@H]1CC(=O)C(=[N+]=[N-])C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H23N5O11/c1-25(2,41-24(34)40-13-15-5-9-17(10-6-15)30(37)38)20-18(27-22(20)32)11-19(31)21(28-26)23(33)39-12-14-3-7-16(8-4-14)29(35)36/h3-10,18,20H,11-13H2,1-2H3,(H,27,32)/t18-,20+/m1/s1 |
| InChIKey | VIAOLKKXWHJPRA-QUCCMNQESA-N |
| XLogP | 2.42 |
| TPSA | 230.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.48 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|