C19H21N5O8 — CID 155099517
(4-nitrophenyl)methyl 2-diazo-4-[(2R,3R)-3-[(1R)-1-(methoxycarbonylamino)ethyl]-4-oxoazetidin-2-yl]-3-oxopentanoate (PubChem CID 155099517) has the molecular formula C19H21N5O8 and a molecular weight of 447.40 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-diazo-4-[(2R,3R)-3-[(1R)-1-(methoxycarbonylamino)ethyl]-4-oxoazetidin-2-yl]-3-oxopentanoate.
| Compound Name | (4-nitrophenyl)methyl 2-diazo-4-[(2R,3R)-3-[(1R)-1-(methoxycarbonylamino)ethyl]-4-oxoazetidin-2-yl]-3-oxopentanoate |
|---|---|
| PubChem CID | 155099517 |
| Molecular Formula | C19H21N5O8 |
| Molecular Weight | 447.40 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | (4-nitrophenyl)methyl 2-diazo-4-[(2R,3R)-3-[(1R)-1-(methoxycarbonylamino)ethyl]-4-oxoazetidin-2-yl]-3-oxopentanoate |
| SMILES | COC(=O)N[C@H](C)[C@H]1C(=O)N[C@@H]1C(C)C(=O)C(=[N+]=[N-])C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H21N5O8/c1-9(14-13(17(26)22-14)10(2)21-19(28)31-3)16(25)15(23-20)18(27)32-8-11-4-6-12(7-5-11)24(29)30/h4-7,9-10,13-14H,8H2,1-3H3,(H,21,28)(H,22,26)/t9?,10-,13-,14-/m1/s1 |
| InChIKey | WPRRVYFMGHLISC-KKUMGRFKSA-N |
| XLogP | 0.37 |
| TPSA | 190.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.40 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|