C28H27N9O10 — CID 175279310
(4-nitrophenyl)methyl 2-diazo-4-[(2R,3S)-3-[1-[4-[[(4-nitrophenyl)methoxycarbonylamino]methyl]triazol-1-yl]ethyl]-4-oxoazetidin-2-yl]-3-oxopentanoate (PubChem CID 175279310) has the molecular formula C28H27N9O10 and a molecular weight of 649.58 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-diazo-4-[(2R,3S)-3-[1-[4-[[(4-nitrophenyl)methoxycarbonylamino]methyl]triazol-1-yl]ethyl]-4-oxoazetidin-2-yl]-3-oxopentanoate.
| Compound Name | (4-nitrophenyl)methyl 2-diazo-4-[(2R,3S)-3-[1-[4-[[(4-nitrophenyl)methoxycarbonylamino]methyl]triazol-1-yl]ethyl]-4-oxoazetidin-2-yl]-3-oxopentanoate |
|---|---|
| PubChem CID | 175279310 |
| Molecular Formula | C28H27N9O10 |
| Molecular Weight | 649.58 g/mol |
| Exact Mass | 649.19 |
| IUPAC Name | (4-nitrophenyl)methyl 2-diazo-4-[(2R,3S)-3-[1-[4-[[(4-nitrophenyl)methoxycarbonylamino]methyl]triazol-1-yl]ethyl]-4-oxoazetidin-2-yl]-3-oxopentanoate |
| SMILES | CC(C(=O)C(=[N+]=[N-])C(=O)OCc1ccc([N+](=O)[O-])cc1)[C@H]1NC(=O)[C@@H]1C(C)n1cc(CNC(=O)OCc2ccc([N+](=O)[O-])cc2)nn1 |
| InChI | InChI=1S/C28H27N9O10/c1-15(25(38)24(32-29)27(40)46-13-17-3-7-20(8-4-17)36(42)43)23-22(26(39)31-23)16(2)35-12-19(33-34-35)11-30-28(41)47-14-18-5-9-21(10-6-18)37(44)45/h3-10,12,15-16,22-23H,11,13-14H2,1-2H3,(H,30,41)(H,31,39)/t15?,16?,22-,23-/m1/s1 |
| InChIKey | TYBCOTDJNAGLOA-NFWVCLONSA-N |
| XLogP | 1.82 |
| TPSA | 264.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.58 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|