C22H25N5O9 — CID 155613610
[2-diazo-4-[(2R,3R)-3-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-4-oxoazetidin-2-yl]-3-oxopentanoyl] 4-nitrobenzoate (PubChem CID 155613610) has the molecular formula C22H25N5O9 and a molecular weight of 503.47 g/mol. Its IUPAC name is [2-diazo-4-[(2R,3R)-3-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-4-oxoazetidin-2-yl]-3-oxopentanoyl] 4-nitrobenzoate.
| Compound Name | [2-diazo-4-[(2R,3R)-3-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-4-oxoazetidin-2-yl]-3-oxopentanoyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 155613610 |
| Molecular Formula | C22H25N5O9 |
| Molecular Weight | 503.47 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | [2-diazo-4-[(2R,3R)-3-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-4-oxoazetidin-2-yl]-3-oxopentanoyl] 4-nitrobenzoate |
| SMILES | CC(C(=O)C(=[N+]=[N-])C(=O)OC(=O)c1ccc([N+](=O)[O-])cc1)[C@H]1NC(=O)[C@@H]1C(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H25N5O9/c1-10(15-14(18(29)25-15)11(2)24-21(32)36-22(3,4)5)17(28)16(26-23)20(31)35-19(30)12-6-8-13(9-7-12)27(33)34/h6-11,14-15H,1-5H3,(H,24,32)(H,25,29)/t10?,11?,14-,15-/m1/s1 |
| InChIKey | RAOHLDGTOILJMP-FWFPMQDGSA-N |
| XLogP | 1.18 |
| TPSA | 207.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.47 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|