About 2-diazo-4-[(2R,3R)-3-[1-(methoxycarbothioylamino)ethyl]-4-oxoazetidin-2-yl]-3-oxopentanoic acid
2-diazo-4-[(2R,3R)-3-[1-(methoxycarbothioylamino)ethyl]-4-oxoazetidin-2-yl]-3-oxopentanoic acid (PubChem CID 175279333) has the molecular formula C12H16N4O5S
and a molecular weight of 328.35 g/mol. Its IUPAC name is 2-diazo-4-[(2R,3R)-3-[1-(methoxycarbothioylamino)ethyl]-4-oxoazetidin-2-yl]-3-oxopentanoic acid.
Molecular Properties
| Compound Name | 2-diazo-4-[(2R,3R)-3-[1-(methoxycarbothioylamino)ethyl]-4-oxoazetidin-2-yl]-3-oxopentanoic acid |
| PubChem CID | 175279333 |
| Molecular Formula | C12H16N4O5S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 2-diazo-4-[(2R,3R)-3-[1-(methoxycarbothioylamino)ethyl]-4-oxoazetidin-2-yl]-3-oxopentanoic acid |
| SMILES | COC(=S)NC(C)[C@H]1C(=O)N[C@@H]1C(C)C(=O)C(=[N+]=[N-])C(=O)O |
| InChI | InChI=1S/C12H16N4O5S/c1-4(9(17)8(16-13)11(19)20)7-6(10(18)15-7)5(2)14-12(22)21-3/h4-7H,1-3H3,(H,14,22)(H,15,18)(H,19,20)/t4?,5?,6-,7-/m1/s1 |
| InChIKey | UGTPIQUVUVZHSC-TVVDDFTJSA-N |
| XLogP | -1.03 |
| TPSA | 141.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-diazo-4-[(2R,3R)-3-[1-(methoxycarbothioylamino)ethyl]-4-oxoazetidin-2-yl]-3-oxopentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diazo-4-[(2R,3R)-3-[1-(methoxycarbothioylamino)ethyl]-4-oxoazetidin-2-yl]-3-oxopentanoic acid?
The IUPAC name of 2-diazo-4-[(2R,3R)-3-[1-(methoxycarbothioylamino)ethyl]-4-oxoazetidin-2-yl]-3-oxopentanoic acid (CID 175279333) is 2-diazo-4-[(2R,3R)-3-[1-(methoxycarbothioylamino)ethyl]-4-oxoazetidin-2-yl]-3-oxopentanoic acid.
What is the SMILES notation for 2-diazo-4-[(2R,3R)-3-[1-(methoxycarbothioylamino)ethyl]-4-oxoazetidin-2-yl]-3-oxopentanoic acid?
The canonical SMILES for 2-diazo-4-[(2R,3R)-3-[1-(methoxycarbothioylamino)ethyl]-4-oxoazetidin-2-yl]-3-oxopentanoic acid is COC(=S)NC(C)[C@H]1C(=O)N[C@@H]1C(C)C(=O)C(=[N+]=[N-])C(=O)O.
What is the InChIKey of 2-diazo-4-[(2R,3R)-3-[1-(methoxycarbothioylamino)ethyl]-4-oxoazetidin-2-yl]-3-oxopentanoic acid?
The InChIKey is UGTPIQUVUVZHSC-TVVDDFTJSA-N. The full InChI is InChI=1S/C12H16N4O5S/c1-4(9(17)8(16-13)11(19)20)7-6(10(18)15-7)5(2)14-12(22)21-3/h4-7H,1-3H3,(H,14,22)(H,15,18)(H,19,20)/t4?,5?,6-,7-/m1/s1.
What are the key properties of 2-diazo-4-[(2R,3R)-3-[1-(methoxycarbothioylamino)ethyl]-4-oxoazetidin-2-yl]-3-oxopentanoic acid?
2-diazo-4-[(2R,3R)-3-[1-(methoxycarbothioylamino)ethyl]-4-oxoazetidin-2-yl]-3-oxopentanoic acid has a molecular weight of 328.35 g/mol, XLogP of -1.03, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diazo-4-[(2R,3R)-3-[1-(methoxycarbothioylamino)ethyl]-4-oxoazetidin-2-yl]-3-oxopentanoic acid is sourced from PubChem (CID 175279333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).