C22H37N3O7Si — CID 90726980
2,2-dimethylpropanoyloxymethyl (4R)-4-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-2-diazo-3-oxopentanoate (PubChem CID 90726980) has the molecular formula C22H37N3O7Si and a molecular weight of 483.64 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl (4R)-4-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-2-diazo-3-oxopentanoate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl (4R)-4-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-2-diazo-3-oxopentanoate |
|---|---|
| PubChem CID | 90726980 |
| Molecular Formula | C22H37N3O7Si |
| Molecular Weight | 483.64 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl (4R)-4-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-2-diazo-3-oxopentanoate |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N[C@@H]1[C@@H](C)C(=O)C(=[N+]=[N-])C(=O)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C22H37N3O7Si/c1-12(15-14(18(27)24-15)13(2)32-33(9,10)22(6,7)8)17(26)16(25-23)19(28)30-11-31-20(29)21(3,4)5/h12-15H,11H2,1-10H3,(H,24,27)/t12-,13-,14-,15-/m1/s1 |
| InChIKey | HYUJXAXDXVJVOL-KBUPBQIOSA-N |
| XLogP | 2.48 |
| TPSA | 144.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.64 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|