C18H31I2NO4Si — CID 102519854
ethyl (E,4R)-4-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-2,3-diiodopent-2-enoate (PubChem CID 102519854) has the molecular formula C18H31I2NO4Si and a molecular weight of 607.34 g/mol. Its IUPAC name is ethyl (E,4R)-4-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-2,3-diiodopent-2-enoate.
| Compound Name | ethyl (E,4R)-4-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-2,3-diiodopent-2-enoate |
|---|---|
| PubChem CID | 102519854 |
| Molecular Formula | C18H31I2NO4Si |
| Molecular Weight | 607.34 g/mol |
| Exact Mass | 607.01 |
| IUPAC Name | ethyl (E,4R)-4-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-2,3-diiodopent-2-enoate |
| SMILES | CCOC(=O)/C(I)=C(\I)[C@H](C)[C@H]1NC(=O)[C@@H]1[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H31I2NO4Si/c1-9-24-17(23)14(20)13(19)10(2)15-12(16(22)21-15)11(3)25-26(7,8)18(4,5)6/h10-12,15H,9H2,1-8H3,(H,21,22)/b14-13+/t10-,11+,12+,15+/m0/s1 |
| InChIKey | SYRRCMDVPUHEMU-RXMVNBGLSA-N |
| XLogP | 4.79 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.34 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|