C15H29NO4Si — CID 67642904
[(2R,3R)-3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl] 2-methylpropanoate (PubChem CID 67642904) has the molecular formula C15H29NO4Si and a molecular weight of 315.49 g/mol. Its IUPAC name is [(2R,3R)-3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl] 2-methylpropanoate.
| Compound Name | [(2R,3R)-3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 67642904 |
| Molecular Formula | C15H29NO4Si |
| Molecular Weight | 315.49 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | [(2R,3R)-3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)O[C@H]1NC(=O)[C@@H]1C(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H29NO4Si/c1-9(2)14(18)19-13-11(12(17)16-13)10(3)20-21(7,8)15(4,5)6/h9-11,13H,1-8H3,(H,16,17)/t10?,11-,13+/m0/s1 |
| InChIKey | JKWWCMSTUZYMTP-QMDRTORHSA-N |
| XLogP | 2.67 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|