C14H29NO2SSi — CID 10709586
(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-propan-2-ylsulfanylazetidin-2-one (PubChem CID 10709586) has the molecular formula C14H29NO2SSi and a molecular weight of 303.54 g/mol. Its IUPAC name is (3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-propan-2-ylsulfanylazetidin-2-one.
| Compound Name | (3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-propan-2-ylsulfanylazetidin-2-one |
|---|---|
| PubChem CID | 10709586 |
| Molecular Formula | C14H29NO2SSi |
| Molecular Weight | 303.54 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | (3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-propan-2-ylsulfanylazetidin-2-one |
| SMILES | CC(C)S[C@H]1NC(=O)[C@@H]1[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H29NO2SSi/c1-9(2)18-13-11(12(16)15-13)10(3)17-19(7,8)14(4,5)6/h9-11,13H,1-8H3,(H,15,16)/t10-,11+,13-/m1/s1 |
| InChIKey | MHFRLOKXBCAXIH-NTZNESFSSA-N |
| XLogP | 3.61 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.54 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|