C13H25NO4Si — CID 13073908
methyl (2R,3S)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidine-2-carboxylate (PubChem CID 13073908) has the molecular formula C13H25NO4Si and a molecular weight of 287.43 g/mol. Its IUPAC name is methyl (2R,3S)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidine-2-carboxylate.
| Compound Name | methyl (2R,3S)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidine-2-carboxylate |
|---|---|
| PubChem CID | 13073908 |
| Molecular Formula | C13H25NO4Si |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | methyl (2R,3S)-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1NC(=O)[C@@H]1[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H25NO4Si/c1-8(18-19(6,7)13(2,3)4)9-10(12(16)17-5)14-11(9)15/h8-10H,1-7H3,(H,14,15)/t8-,9+,10+/m0/s1 |
| InChIKey | CTTSMVPZBSELSX-IVZWLZJFSA-N |
| XLogP | 1.68 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|