C17H27NO2Si — CID 87213583
(3R,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-hexa-1,2,4,5-tetraen-3-ylazetidin-2-one (PubChem CID 87213583) has the molecular formula C17H27NO2Si and a molecular weight of 305.49 g/mol. Its IUPAC name is (3R,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-hexa-1,2,4,5-tetraen-3-ylazetidin-2-one.
| Compound Name | (3R,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-hexa-1,2,4,5-tetraen-3-ylazetidin-2-one |
|---|---|
| PubChem CID | 87213583 |
| Molecular Formula | C17H27NO2Si |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | (3R,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-hexa-1,2,4,5-tetraen-3-ylazetidin-2-one |
| SMILES | C=C=CC(=C=C)[C@H]1NC(=O)[C@H]1[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H27NO2Si/c1-9-11-13(10-2)15-14(16(19)18-15)12(3)20-21(7,8)17(4,5)6/h11-12,14-15H,1-2H2,3-8H3,(H,18,19)/t12-,14+,15-/m1/s1 |
| InChIKey | PAPILTBHACZJPA-VHDGCEQUSA-N |
| XLogP | 3.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|