C18H33NO2Si — CID 101437016
(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(4,4-dimethylpent-1-yn-3-yl)azetidin-2-one (PubChem CID 101437016) has the molecular formula C18H33NO2Si and a molecular weight of 323.55 g/mol. Its IUPAC name is (3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(4,4-dimethylpent-1-yn-3-yl)azetidin-2-one.
| Compound Name | (3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(4,4-dimethylpent-1-yn-3-yl)azetidin-2-one |
|---|---|
| PubChem CID | 101437016 |
| Molecular Formula | C18H33NO2Si |
| Molecular Weight | 323.55 g/mol |
| Exact Mass | 323.23 |
| IUPAC Name | (3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(4,4-dimethylpent-1-yn-3-yl)azetidin-2-one |
| SMILES | C#CC([C@H]1NC(=O)[C@@H]1[C@@H](C)O[Si](C)(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H33NO2Si/c1-11-13(17(3,4)5)15-14(16(20)19-15)12(2)21-22(9,10)18(6,7)8/h1,12-15H,2-10H3,(H,19,20)/t12-,13?,14-,15-/m1/s1 |
| InChIKey | ADRWAWBVDQZZID-RNLVXLIHSA-N |
| XLogP | 3.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.55 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|