C17H30N2O3Si — CID 142637293
(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(2R)-1-(1,2-oxazol-3-yl)propan-2-yl]azetidin-2-one (PubChem CID 142637293) has the molecular formula C17H30N2O3Si and a molecular weight of 338.52 g/mol. Its IUPAC name is (3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(2R)-1-(1,2-oxazol-3-yl)propan-2-yl]azetidin-2-one.
| Compound Name | (3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(2R)-1-(1,2-oxazol-3-yl)propan-2-yl]azetidin-2-one |
|---|---|
| PubChem CID | 142637293 |
| Molecular Formula | C17H30N2O3Si |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | (3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(2R)-1-(1,2-oxazol-3-yl)propan-2-yl]azetidin-2-one |
| SMILES | C[C@H](Cc1ccon1)[C@H]1NC(=O)[C@@H]1[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H30N2O3Si/c1-11(10-13-8-9-21-19-13)15-14(16(20)18-15)12(2)22-23(6,7)17(3,4)5/h8-9,11-12,14-15H,10H2,1-7H3,(H,18,20)/t11-,12-,14-,15-/m1/s1 |
| InChIKey | MULYNFGIPWHPEO-QHSBEEBCSA-N |
| XLogP | 3.38 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|