C20H32N2O2SSi — CID 57291982
(3S,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(2R)-1-(4-methyl-2-pyridinyl)-1-sulfanylidenepropan-2-yl]azetidin-2-one (PubChem CID 57291982) has the molecular formula C20H32N2O2SSi and a molecular weight of 392.64 g/mol. Its IUPAC name is (3S,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(2R)-1-(4-methyl-2-pyridinyl)-1-sulfanylidenepropan-2-yl]azetidin-2-one.
| Compound Name | (3S,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(2R)-1-(4-methyl-2-pyridinyl)-1-sulfanylidenepropan-2-yl]azetidin-2-one |
|---|---|
| PubChem CID | 57291982 |
| Molecular Formula | C20H32N2O2SSi |
| Molecular Weight | 392.64 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | (3S,4S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[(2R)-1-(4-methyl-2-pyridinyl)-1-sulfanylidenepropan-2-yl]azetidin-2-one |
| SMILES | Cc1ccnc(C(=S)[C@H](C)[C@H]2NC(=O)[C@@H]2[C@@H](C)O[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C20H32N2O2SSi/c1-12-9-10-21-15(11-12)18(25)13(2)17-16(19(23)22-17)14(3)24-26(7,8)20(4,5)6/h9-11,13-14,16-17H,1-8H3,(H,22,23)/t13-,14-,16-,17-/m1/s1 |
| InChIKey | BXMNXQDDPFDQHT-MUIFIZLQSA-N |
| XLogP | 4.27 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.64 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|