C12H25NO4SSi — CID 14486195
3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methylsulfonylazetidin-2-one (PubChem CID 14486195) has the molecular formula C12H25NO4SSi and a molecular weight of 307.49 g/mol. Its IUPAC name is 3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methylsulfonylazetidin-2-one.
| Compound Name | 3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methylsulfonylazetidin-2-one |
|---|---|
| PubChem CID | 14486195 |
| Molecular Formula | C12H25NO4SSi |
| Molecular Weight | 307.49 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methylsulfonylazetidin-2-one |
| SMILES | CC(O[Si](C)(C)C(C)(C)C)C1C(=O)NC1S(C)(=O)=O |
| InChI | InChI=1S/C12H25NO4SSi/c1-8(17-19(6,7)12(2,3)4)9-10(14)13-11(9)18(5,15)16/h8-9,11H,1-7H3,(H,13,14) |
| InChIKey | JWVYCZMIMAQARB-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.49 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|