C14H27NO4Si — CID 14395942
methyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]acetate (PubChem CID 14395942) has the molecular formula C14H27NO4Si and a molecular weight of 301.46 g/mol. Its IUPAC name is methyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]acetate.
| Compound Name | methyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]acetate |
|---|---|
| PubChem CID | 14395942 |
| Molecular Formula | C14H27NO4Si |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | methyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1NC(=O)[C@@H]1[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H27NO4Si/c1-9(19-20(6,7)14(2,3)4)12-10(15-13(12)17)8-11(16)18-5/h9-10,12H,8H2,1-7H3,(H,15,17)/t9-,10-,12-/m1/s1 |
| InChIKey | AOMZYHXUFSLVAZ-CKYFFXLPSA-N |
| XLogP | 2.07 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|