C23H43NO5Si — CID 10765625
[(2R)-octan-2-yl] 4-[(3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-3-oxobutanoate (PubChem CID 10765625) has the molecular formula C23H43NO5Si and a molecular weight of 441.69 g/mol. Its IUPAC name is [(2R)-octan-2-yl] 4-[(3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-3-oxobutanoate.
| Compound Name | [(2R)-octan-2-yl] 4-[(3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-3-oxobutanoate |
|---|---|
| PubChem CID | 10765625 |
| Molecular Formula | C23H43NO5Si |
| Molecular Weight | 441.69 g/mol |
| Exact Mass | 441.29 |
| IUPAC Name | [(2R)-octan-2-yl] 4-[(3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-3-oxobutanoate |
| SMILES | CCCCCC[C@@H](C)OC(=O)CC(=O)CC1NC(=O)[C@@H]1[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H43NO5Si/c1-9-10-11-12-13-16(2)28-20(26)15-18(25)14-19-21(22(27)24-19)17(3)29-30(7,8)23(4,5)6/h16-17,19,21H,9-15H2,1-8H3,(H,24,27)/t16-,17-,19?,21-/m1/s1 |
| InChIKey | GSEUPEJWKIHWKW-XNTWYNPMSA-N |
| XLogP | 4.76 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.69 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|