C15H29NO2Si — CID 100963871
(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(2-methylprop-2-enyl)azetidin-2-one (PubChem CID 100963871) has the molecular formula C15H29NO2Si and a molecular weight of 283.49 g/mol. Its IUPAC name is (3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(2-methylprop-2-enyl)azetidin-2-one.
| Compound Name | (3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(2-methylprop-2-enyl)azetidin-2-one |
|---|---|
| PubChem CID | 100963871 |
| Molecular Formula | C15H29NO2Si |
| Molecular Weight | 283.49 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | (3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-(2-methylprop-2-enyl)azetidin-2-one |
| SMILES | C=C(C)C[C@H]1NC(=O)[C@@H]1[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H29NO2Si/c1-10(2)9-12-13(14(17)16-12)11(3)18-19(7,8)15(4,5)6/h11-13H,1,9H2,2-8H3,(H,16,17)/t11-,12-,13-/m1/s1 |
| InChIKey | VVKYAVISZFMJEF-JHJVBQTASA-N |
| XLogP | 3.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|