C22H38N2O4Si — CID 67792562
(3S,4R)-4-[4-[(2S)-1-acetylpyrrolidin-2-yl]-3-methyl-2-oxobut-3-enyl]-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]azetidin-2-one (PubChem CID 67792562) has the molecular formula C22H38N2O4Si and a molecular weight of 422.64 g/mol. Its IUPAC name is (3S,4R)-4-[4-[(2S)-1-acetylpyrrolidin-2-yl]-3-methyl-2-oxobut-3-enyl]-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]azetidin-2-one.
| Compound Name | (3S,4R)-4-[4-[(2S)-1-acetylpyrrolidin-2-yl]-3-methyl-2-oxobut-3-enyl]-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]azetidin-2-one |
|---|---|
| PubChem CID | 67792562 |
| Molecular Formula | C22H38N2O4Si |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | (3S,4R)-4-[4-[(2S)-1-acetylpyrrolidin-2-yl]-3-methyl-2-oxobut-3-enyl]-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]azetidin-2-one |
| SMILES | CC(=O)N1CCC[C@H]1C=C(C)C(=O)C[C@H]1NC(=O)[C@@H]1[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H38N2O4Si/c1-14(12-17-10-9-11-24(17)16(3)25)19(26)13-18-20(21(27)23-18)15(2)28-29(7,8)22(4,5)6/h12,15,17-18,20H,9-11,13H2,1-8H3,(H,23,27)/t15-,17+,18-,20-/m1/s1 |
| InChIKey | KSBBNXXKMWPRNA-MJKGWSOKSA-N |
| XLogP | 3.43 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|