C24H39N3O7Si — CID 15117310
bis(prop-2-enyl) 4-[2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]acetyl]pyrazolidine-1,2-dicarboxylate (PubChem CID 15117310) has the molecular formula C24H39N3O7Si and a molecular weight of 509.68 g/mol. Its IUPAC name is bis(prop-2-enyl) 4-[2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]acetyl]pyrazolidine-1,2-dicarboxylate.
| Compound Name | bis(prop-2-enyl) 4-[2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]acetyl]pyrazolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 15117310 |
| Molecular Formula | C24H39N3O7Si |
| Molecular Weight | 509.68 g/mol |
| Exact Mass | 509.26 |
| IUPAC Name | bis(prop-2-enyl) 4-[2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]acetyl]pyrazolidine-1,2-dicarboxylate |
| SMILES | C=CCOC(=O)N1CC(C(=O)C[C@H]2NC(=O)[C@@H]2[C@@H](C)O[Si](C)(C)C(C)(C)C)CN1C(=O)OCC=C |
| InChI | InChI=1S/C24H39N3O7Si/c1-9-11-32-22(30)26-14-17(15-27(26)23(31)33-12-10-2)19(28)13-18-20(21(29)25-18)16(3)34-35(7,8)24(4,5)6/h9-10,16-18,20H,1-2,11-15H2,3-8H3,(H,25,29)/t16-,18-,20-/m1/s1 |
| InChIKey | FPMKEBFCYOEOOX-YVWKXTFCSA-N |
| XLogP | 3.26 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.68 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|