C25H42N2O7Si — CID 139783691
1-O-tert-butyl 4-O-prop-2-enyl 4-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-3-oxopiperidine-1,4-dicarboxylate (PubChem CID 139783691) has the molecular formula C25H42N2O7Si and a molecular weight of 510.70 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-prop-2-enyl 4-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-3-oxopiperidine-1,4-dicarboxylate.
| Compound Name | 1-O-tert-butyl 4-O-prop-2-enyl 4-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-3-oxopiperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 139783691 |
| Molecular Formula | C25H42N2O7Si |
| Molecular Weight | 510.70 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | 1-O-tert-butyl 4-O-prop-2-enyl 4-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-3-oxopiperidine-1,4-dicarboxylate |
| SMILES | C=CCOC(=O)C1([C@@H]2NC(=O)[C@@H]2[C@@H](C)O[Si](C)(C)C(C)(C)C)CCN(C(=O)OC(C)(C)C)CC1=O |
| InChI | InChI=1S/C25H42N2O7Si/c1-11-14-32-21(30)25(12-13-27(15-17(25)28)22(31)33-23(3,4)5)19-18(20(29)26-19)16(2)34-35(9,10)24(6,7)8/h11,16,18-19H,1,12-15H2,2-10H3,(H,26,29)/t16-,18-,19-,25?/m1/s1 |
| InChIKey | LLNAAFDFPFKAIH-ZXJILFLZSA-N |
| XLogP | 3.44 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.70 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|