C21H38N2O6Si — CID 67711875
(2R)-2-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-5-[methyl(prop-2-enoxycarbonyl)amino]pentanoic acid (PubChem CID 67711875) has the molecular formula C21H38N2O6Si and a molecular weight of 442.63 g/mol. Its IUPAC name is (2R)-2-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-5-[methyl(prop-2-enoxycarbonyl)amino]pentanoic acid.
| Compound Name | (2R)-2-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-5-[methyl(prop-2-enoxycarbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 67711875 |
| Molecular Formula | C21H38N2O6Si |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | (2R)-2-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-5-[methyl(prop-2-enoxycarbonyl)amino]pentanoic acid |
| SMILES | C=CCOC(=O)N(C)CCC[C@@H](C(=O)O)[C@H]1NC(=O)[C@@H]1[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H38N2O6Si/c1-9-13-28-20(27)23(6)12-10-11-15(19(25)26)17-16(18(24)22-17)14(2)29-30(7,8)21(3,4)5/h9,14-17H,1,10-13H2,2-8H3,(H,22,24)(H,25,26)/t14-,15-,16-,17-/m1/s1 |
| InChIKey | DRWNYJWOKYBRPN-QBPKDAKJSA-N |
| XLogP | 3.25 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|