C18H33NO5Si — CID 139631668
2-[(2R)-2-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]but-3-enoxy]propanoic acid (PubChem CID 139631668) has the molecular formula C18H33NO5Si and a molecular weight of 371.55 g/mol. Its IUPAC name is 2-[(2R)-2-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]but-3-enoxy]propanoic acid.
| Compound Name | 2-[(2R)-2-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]but-3-enoxy]propanoic acid |
|---|---|
| PubChem CID | 139631668 |
| Molecular Formula | C18H33NO5Si |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 2-[(2R)-2-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]but-3-enoxy]propanoic acid |
| SMILES | C=C[C@@H](COC(C)C(=O)O)[C@@H]1NC(=O)[C@@H]1[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H33NO5Si/c1-9-13(10-23-12(3)17(21)22)15-14(16(20)19-15)11(2)24-25(7,8)18(4,5)6/h9,11-15H,1,10H2,2-8H3,(H,19,20)(H,21,22)/t11-,12?,13+,14-,15+/m1/s1 |
| InChIKey | OXYSGQSSEGRCHC-DYALRZPUSA-N |
| XLogP | 2.80 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|