C25H43FN2O6SSi — CID 57044169
prop-2-enyl (2S,4S)-4-[2-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]propanoylsulfanyl]-2-(2-fluoroethoxymethyl)pyrrolidine-1-carboxylate (PubChem CID 57044169) has the molecular formula C25H43FN2O6SSi and a molecular weight of 546.78 g/mol. Its IUPAC name is prop-2-enyl (2S,4S)-4-[2-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]propanoylsulfanyl]-2-(2-fluoroethoxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2S,4S)-4-[2-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]propanoylsulfanyl]-2-(2-fluoroethoxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57044169 |
| Molecular Formula | C25H43FN2O6SSi |
| Molecular Weight | 546.78 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | prop-2-enyl (2S,4S)-4-[2-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]propanoylsulfanyl]-2-(2-fluoroethoxymethyl)pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@@H](SC(=O)C(C)[C@H]2NC(=O)[C@@H]2[C@@H](C)O[Si](C)(C)C(C)(C)C)C[C@H]1COCCF |
| InChI | InChI=1S/C25H43FN2O6SSi/c1-9-11-33-24(31)28-14-19(13-18(28)15-32-12-10-26)35-23(30)16(2)21-20(22(29)27-21)17(3)34-36(7,8)25(4,5)6/h9,16-21H,1,10-15H2,2-8H3,(H,27,29)/t16?,17-,18+,19+,20-,21-/m1/s1 |
| InChIKey | BZKOWLMFOOUNTA-QDHPPPJYSA-N |
| XLogP | 4.16 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.78 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|