C16H29NO4SSi — CID 10926469
prop-2-enyl 2-[(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-sulfanylazetidin-1-yl]acetate (PubChem CID 10926469) has the molecular formula C16H29NO4SSi and a molecular weight of 359.56 g/mol. Its IUPAC name is prop-2-enyl 2-[(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-sulfanylazetidin-1-yl]acetate.
| Compound Name | prop-2-enyl 2-[(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-sulfanylazetidin-1-yl]acetate |
|---|---|
| PubChem CID | 10926469 |
| Molecular Formula | C16H29NO4SSi |
| Molecular Weight | 359.56 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | prop-2-enyl 2-[(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-sulfanylazetidin-1-yl]acetate |
| SMILES | C=CCOC(=O)CN1C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H]1S |
| InChI | InChI=1S/C16H29NO4SSi/c1-8-9-20-12(18)10-17-14(19)13(15(17)22)11(2)21-23(6,7)16(3,4)5/h8,11,13,15,22H,1,9-10H2,2-7H3/t11-,13+,15-/m1/s1 |
| InChIKey | QIWWLABTNMIDEJ-OSAQELSMSA-N |
| XLogP | 2.84 |
| TPSA | 55.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.56 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|