C22H33NO5Si — CID 11732541
prop-2-enyl (2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-1-(4-methoxyphenyl)-4-oxoazetidine-2-carboxylate (PubChem CID 11732541) has the molecular formula C22H33NO5Si and a molecular weight of 419.59 g/mol. Its IUPAC name is prop-2-enyl (2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-1-(4-methoxyphenyl)-4-oxoazetidine-2-carboxylate.
| Compound Name | prop-2-enyl (2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-1-(4-methoxyphenyl)-4-oxoazetidine-2-carboxylate |
|---|---|
| PubChem CID | 11732541 |
| Molecular Formula | C22H33NO5Si |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | prop-2-enyl (2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-1-(4-methoxyphenyl)-4-oxoazetidine-2-carboxylate |
| SMILES | C=CCOC(=O)[C@H]1[C@@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)C(=O)N1c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H33NO5Si/c1-9-14-27-21(25)19-18(15(2)28-29(7,8)22(3,4)5)20(24)23(19)16-10-12-17(26-6)13-11-16/h9-13,15,18-19H,1,14H2,2-8H3/t15-,18-,19-/m1/s1 |
| InChIKey | HMIJROUQPOLUDP-ATZDWAIDSA-N |
| XLogP | 4.17 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|