C25H35NO5Si — CID 11408481
methyl (E)-4-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[2-(4-methoxyphenyl)ethynyl]-4-oxoazetidin-1-yl]but-3-enoate (PubChem CID 11408481) has the molecular formula C25H35NO5Si and a molecular weight of 457.64 g/mol. Its IUPAC name is methyl (E)-4-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[2-(4-methoxyphenyl)ethynyl]-4-oxoazetidin-1-yl]but-3-enoate.
| Compound Name | methyl (E)-4-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[2-(4-methoxyphenyl)ethynyl]-4-oxoazetidin-1-yl]but-3-enoate |
|---|---|
| PubChem CID | 11408481 |
| Molecular Formula | C25H35NO5Si |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | methyl (E)-4-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-[2-(4-methoxyphenyl)ethynyl]-4-oxoazetidin-1-yl]but-3-enoate |
| SMILES | COC(=O)C/C=C/N1C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H]1C#Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C25H35NO5Si/c1-18(31-32(7,8)25(2,3)4)23-21(16-13-19-11-14-20(29-5)15-12-19)26(24(23)28)17-9-10-22(27)30-6/h9,11-12,14-15,17-18,21,23H,10H2,1-8H3/b17-9+/t18-,21-,23-/m1/s1 |
| InChIKey | PGZKMFZGDOTUJJ-UIWREYNRSA-N |
| XLogP | 4.36 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|