C20H32N2O6SSi — CID 88662950
methyl 2-[3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(2,5-dioxopyrrolidin-1-yl)sulfanyl-4-oxoazetidin-1-yl]but-3-enoate (PubChem CID 88662950) has the molecular formula C20H32N2O6SSi and a molecular weight of 456.64 g/mol. Its IUPAC name is methyl 2-[3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(2,5-dioxopyrrolidin-1-yl)sulfanyl-4-oxoazetidin-1-yl]but-3-enoate.
| Compound Name | methyl 2-[3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(2,5-dioxopyrrolidin-1-yl)sulfanyl-4-oxoazetidin-1-yl]but-3-enoate |
|---|---|
| PubChem CID | 88662950 |
| Molecular Formula | C20H32N2O6SSi |
| Molecular Weight | 456.64 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | methyl 2-[3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-(2,5-dioxopyrrolidin-1-yl)sulfanyl-4-oxoazetidin-1-yl]but-3-enoate |
| SMILES | C=CC(C(=O)OC)N1C(=O)C([C@@H](C)O[Si](C)(C)C(C)(C)C)C1SN1C(=O)CCC1=O |
| InChI | InChI=1S/C20H32N2O6SSi/c1-9-13(19(26)27-6)21-17(25)16(12(2)28-30(7,8)20(3,4)5)18(21)29-22-14(23)10-11-15(22)24/h9,12-13,16,18H,1,10-11H2,2-8H3/t12-,13?,16?,18?/m1/s1 |
| InChIKey | ZMGXWJLQEOGSIY-HUWYOMQOSA-N |
| XLogP | 2.71 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.64 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|