C34H41NO5SSi — CID 10579526
ethenyl 2-[(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-tritylsulfanylazetidin-1-yl]-2-hydroxyacetate (PubChem CID 10579526) has the molecular formula C34H41NO5SSi and a molecular weight of 603.86 g/mol. Its IUPAC name is ethenyl 2-[(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-tritylsulfanylazetidin-1-yl]-2-hydroxyacetate.
| Compound Name | ethenyl 2-[(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-tritylsulfanylazetidin-1-yl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 10579526 |
| Molecular Formula | C34H41NO5SSi |
| Molecular Weight | 603.86 g/mol |
| Exact Mass | 603.25 |
| IUPAC Name | ethenyl 2-[(3S,4R)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-oxo-4-tritylsulfanylazetidin-1-yl]-2-hydroxyacetate |
| SMILES | C=COC(=O)C(O)N1C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H]1SC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H41NO5SSi/c1-8-39-32(38)30(37)35-29(36)28(24(2)40-42(6,7)33(3,4)5)31(35)41-34(25-18-12-9-13-19-25,26-20-14-10-15-21-26)27-22-16-11-17-23-27/h8-24,28,30-31,37H,1H2,2-7H3/t24-,28+,30?,31-/m1/s1 |
| InChIKey | KCDVVXUAUVFQSP-LBPGCQIESA-N |
| XLogP | 6.91 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.86 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|