C28H32BrNOSSi — CID 57129629
(3S,4R)-3-bromo-1-[tert-butyl(dimethyl)silyl]-4-tritylsulfanylazetidin-2-one (PubChem CID 57129629) has the molecular formula C28H32BrNOSSi and a molecular weight of 538.63 g/mol. Its IUPAC name is (3S,4R)-3-bromo-1-[tert-butyl(dimethyl)silyl]-4-tritylsulfanylazetidin-2-one.
| Compound Name | (3S,4R)-3-bromo-1-[tert-butyl(dimethyl)silyl]-4-tritylsulfanylazetidin-2-one |
|---|---|
| PubChem CID | 57129629 |
| Molecular Formula | C28H32BrNOSSi |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 537.12 |
| IUPAC Name | (3S,4R)-3-bromo-1-[tert-butyl(dimethyl)silyl]-4-tritylsulfanylazetidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)N1C(=O)[C@H](Br)[C@H]1SC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H32BrNOSSi/c1-27(2,3)33(4,5)30-25(31)24(29)26(30)32-28(21-15-9-6-10-16-21,22-17-11-7-12-18-22)23-19-13-8-14-20-23/h6-20,24,26H,1-5H3/t24-,26+/m0/s1 |
| InChIKey | LTJWYDDCHVDKIE-AZGAKELHSA-N |
| XLogP | 7.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|