C17H27NO2SSi — CID 139795168
(3R)-4-(benzenesulfinyl)-1-[tert-butyl(dimethyl)silyl]-3-ethylazetidin-2-one (PubChem CID 139795168) has the molecular formula C17H27NO2SSi and a molecular weight of 337.56 g/mol. Its IUPAC name is (3R)-4-(benzenesulfinyl)-1-[tert-butyl(dimethyl)silyl]-3-ethylazetidin-2-one.
| Compound Name | (3R)-4-(benzenesulfinyl)-1-[tert-butyl(dimethyl)silyl]-3-ethylazetidin-2-one |
|---|---|
| PubChem CID | 139795168 |
| Molecular Formula | C17H27NO2SSi |
| Molecular Weight | 337.56 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | (3R)-4-(benzenesulfinyl)-1-[tert-butyl(dimethyl)silyl]-3-ethylazetidin-2-one |
| SMILES | CC[C@@H]1C(=O)N([Si](C)(C)C(C)(C)C)C1S(=O)c1ccccc1 |
| InChI | InChI=1S/C17H27NO2SSi/c1-7-14-15(19)18(22(5,6)17(2,3)4)16(14)21(20)13-11-9-8-10-12-13/h8-12,14,16H,7H2,1-6H3/t14-,16?,21?/m1/s1 |
| InChIKey | SDYMAPWFPAAPON-HXJYWVFZSA-N |
| XLogP | 3.99 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.56 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|