C33H38N2O4SSi — CID 70439521
(3S,4R)-1-[tert-butyl(dimethyl)silyl]-3-[(2R)-1-methoxy-4-oxoazetidine-2-carbonyl]-4-tritylsulfanylazetidin-2-one (PubChem CID 70439521) has the molecular formula C33H38N2O4SSi and a molecular weight of 586.83 g/mol. Its IUPAC name is (3S,4R)-1-[tert-butyl(dimethyl)silyl]-3-[(2R)-1-methoxy-4-oxoazetidine-2-carbonyl]-4-tritylsulfanylazetidin-2-one.
| Compound Name | (3S,4R)-1-[tert-butyl(dimethyl)silyl]-3-[(2R)-1-methoxy-4-oxoazetidine-2-carbonyl]-4-tritylsulfanylazetidin-2-one |
|---|---|
| PubChem CID | 70439521 |
| Molecular Formula | C33H38N2O4SSi |
| Molecular Weight | 586.83 g/mol |
| Exact Mass | 586.23 |
| IUPAC Name | (3S,4R)-1-[tert-butyl(dimethyl)silyl]-3-[(2R)-1-methoxy-4-oxoazetidine-2-carbonyl]-4-tritylsulfanylazetidin-2-one |
| SMILES | CON1C(=O)C[C@@H]1C(=O)[C@H]1C(=O)N([Si](C)(C)C(C)(C)C)[C@@H]1SC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H38N2O4SSi/c1-32(2,3)41(5,6)35-30(38)28(29(37)26-22-27(36)34(26)39-4)31(35)40-33(23-16-10-7-11-17-23,24-18-12-8-13-19-24)25-20-14-9-15-21-25/h7-21,26,28,31H,22H2,1-6H3/t26-,28+,31-/m1/s1 |
| InChIKey | UVQXXWBVOKFYRY-PNBNRWGDSA-N |
| XLogP | 6.23 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.83 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|