C21H25NO3 — CID 11515617
tert-butyl (2S,3S)-2-[hydroxy(diphenyl)methyl]-3-methylaziridine-1-carboxylate (PubChem CID 11515617) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is tert-butyl (2S,3S)-2-[hydroxy(diphenyl)methyl]-3-methylaziridine-1-carboxylate.
| Compound Name | tert-butyl (2S,3S)-2-[hydroxy(diphenyl)methyl]-3-methylaziridine-1-carboxylate |
|---|---|
| PubChem CID | 11515617 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | tert-butyl (2S,3S)-2-[hydroxy(diphenyl)methyl]-3-methylaziridine-1-carboxylate |
| SMILES | C[C@H]1[C@@H](C(O)(c2ccccc2)c2ccccc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H25NO3/c1-15-18(22(15)19(23)25-20(2,3)4)21(24,16-11-7-5-8-12-16)17-13-9-6-10-14-17/h5-15,18,24H,1-4H3/t15-,18-,22?/m0/s1 |
| InChIKey | QGSGJMWHRMXHRJ-CIQNTRFYSA-N |
| XLogP | 3.93 |
| TPSA | 49.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|