C27H29NO6 — CID 71739896
5-O-tert-butyl 3-O,7-O-dimethyl (1R,2R,3S,4R,6R,7S)-3,7-diphenyl-5-azatricyclo[4.1.0.02,4]heptane-3,5,7-tricarboxylate (PubChem CID 71739896) has the molecular formula C27H29NO6 and a molecular weight of 463.53 g/mol. Its IUPAC name is 5-O-tert-butyl 3-O,7-O-dimethyl (1R,2R,3S,4R,6R,7S)-3,7-diphenyl-5-azatricyclo[4.1.0.02,4]heptane-3,5,7-tricarboxylate.
| Compound Name | 5-O-tert-butyl 3-O,7-O-dimethyl (1R,2R,3S,4R,6R,7S)-3,7-diphenyl-5-azatricyclo[4.1.0.02,4]heptane-3,5,7-tricarboxylate |
|---|---|
| PubChem CID | 71739896 |
| Molecular Formula | C27H29NO6 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 5-O-tert-butyl 3-O,7-O-dimethyl (1R,2R,3S,4R,6R,7S)-3,7-diphenyl-5-azatricyclo[4.1.0.02,4]heptane-3,5,7-tricarboxylate |
| SMILES | COC(=O)[C@]1(c2ccccc2)[C@H]2[C@H]3[C@@H](N(C(=O)OC(C)(C)C)[C@H]21)[C@@]3(C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C27H29NO6/c1-25(2,3)34-24(31)28-20-18(26(20,22(29)32-4)16-12-8-6-9-13-16)19-21(28)27(19,23(30)33-5)17-14-10-7-11-15-17/h6-15,18-21H,1-5H3/t18-,19-,20+,21+,26+,27+/m0/s1 |
| InChIKey | NGXUHDCIQMGEHP-NRLJPGDMSA-N |
| XLogP | 3.46 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|