C15H18O2 — CID 22084933
methyl 7-phenylbicyclo[4.1.0]heptane-7-carboxylate (PubChem CID 22084933) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is methyl 7-phenylbicyclo[4.1.0]heptane-7-carboxylate.
| Compound Name | methyl 7-phenylbicyclo[4.1.0]heptane-7-carboxylate |
|---|---|
| PubChem CID | 22084933 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | methyl 7-phenylbicyclo[4.1.0]heptane-7-carboxylate |
| SMILES | COC(=O)C1(c2ccccc2)C2CCCCC21 |
| InChI | InChI=1S/C15H18O2/c1-17-14(16)15(11-7-3-2-4-8-11)12-9-5-6-10-13(12)15/h2-4,7-8,12-13H,5-6,9-10H2,1H3 |
| InChIKey | REMMSOMDYQFVHB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |