C23H20O2 — CID 100975897
methyl (1S)-1,2,2-triphenylcyclopropane-1-carboxylate (PubChem CID 100975897) has the molecular formula C23H20O2 and a molecular weight of 328.41 g/mol. Its IUPAC name is methyl (1S)-1,2,2-triphenylcyclopropane-1-carboxylate.
| Compound Name | methyl (1S)-1,2,2-triphenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 100975897 |
| Molecular Formula | C23H20O2 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | methyl (1S)-1,2,2-triphenylcyclopropane-1-carboxylate |
| SMILES | COC(=O)[C@]1(c2ccccc2)CC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H20O2/c1-25-21(24)23(20-15-9-4-10-16-20)17-22(23,18-11-5-2-6-12-18)19-13-7-3-8-14-19/h2-16H,17H2,1H3/t23-/m1/s1 |
| InChIKey | SNRZBUVEKYVBAU-HSZRJFAPSA-N |
| XLogP | 4.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |