C19H18O3 — CID 14434450
methyl 1-hydroxy-5,5-diphenylcyclopent-2-ene-1-carboxylate (PubChem CID 14434450) has the molecular formula C19H18O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is methyl 1-hydroxy-5,5-diphenylcyclopent-2-ene-1-carboxylate.
| Compound Name | methyl 1-hydroxy-5,5-diphenylcyclopent-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 14434450 |
| Molecular Formula | C19H18O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | methyl 1-hydroxy-5,5-diphenylcyclopent-2-ene-1-carboxylate |
| SMILES | COC(=O)C1(O)C=CCC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H18O3/c1-22-17(20)19(21)14-8-13-18(19,15-9-4-2-5-10-15)16-11-6-3-7-12-16/h2-12,14,21H,13H2,1H3 |
| InChIKey | QDXRSSZDAJANKJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|