C19H22O2 — CID 162754718
methyl 6-methylidene-3-phenyladamantane-1-carboxylate (PubChem CID 162754718) has the molecular formula C19H22O2 and a molecular weight of 282.38 g/mol. Its IUPAC name is methyl 6-methylidene-3-phenyladamantane-1-carboxylate.
| Compound Name | methyl 6-methylidene-3-phenyladamantane-1-carboxylate |
|---|---|
| PubChem CID | 162754718 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | methyl 6-methylidene-3-phenyladamantane-1-carboxylate |
| SMILES | C=C1C2CC3(C(=O)OC)CC1CC(c1ccccc1)(C2)C3 |
| InChI | InChI=1S/C19H22O2/c1-13-14-8-18(16-6-4-3-5-7-16)9-15(13)11-19(10-14,12-18)17(20)21-2/h3-7,14-15H,1,8-12H2,2H3 |
| InChIKey | XEQCBGSRJLUIOT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|